About (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide
(E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 47109319) has the molecular formula C13H13N3OS
and a molecular weight of 259.33 g/mol. Its IUPAC name is (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide |
| PubChem CID | 47109319 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#CCCN(CCC#N)C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C13H13N3OS/c14-7-2-9-16(10-3-8-15)13(17)6-5-12-4-1-11-18-12/h1,4-6,11H,2-3,9-10H2/b6-5+ |
| InChIKey | TVGFGZFPFAUDGU-AATRIKPKSA-N |
| XLogP | 2.42 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide?
The IUPAC name of (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide (CID 47109319) is (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide.
What is the SMILES notation for (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide?
The canonical SMILES for (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide is N#CCCN(CCC#N)C(=O)/C=C/c1cccs1.
What is the InChIKey of (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide?
The InChIKey is TVGFGZFPFAUDGU-AATRIKPKSA-N. The full InChI is InChI=1S/C13H13N3OS/c14-7-2-9-16(10-3-8-15)13(17)6-5-12-4-1-11-18-12/h1,4-6,11H,2-3,9-10H2/b6-5+.
What are the key properties of (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide?
(E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide has a molecular weight of 259.33 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-bis(2-cyanoethyl)-3-thiophen-2-ylprop-2-enamide is sourced from PubChem (CID 47109319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).