C13H14BrIN2O2 — CID 47113782
5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-2-iodo-N-methylbenzamide (PubChem CID 47113782) has the molecular formula C13H14BrIN2O2 and a molecular weight of 437.08 g/mol. Its IUPAC name is 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-2-iodo-N-methylbenzamide.
| Compound Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-2-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 47113782 |
| Molecular Formula | C13H14BrIN2O2 |
| Molecular Weight | 437.08 g/mol |
| Exact Mass | 435.93 |
| IUPAC Name | 5-bromo-N-[2-(cyclopropylamino)-2-oxoethyl]-2-iodo-N-methylbenzamide |
| SMILES | CN(CC(=O)NC1CC1)C(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C13H14BrIN2O2/c1-17(7-12(18)16-9-3-4-9)13(19)10-6-8(14)2-5-11(10)15/h2,5-6,9H,3-4,7H2,1H3,(H,16,18) |
| InChIKey | CAJWBVMQVIOOLJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|