C15H22N2O2 — CID 47114454
2-(3-methylphenoxy)-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 47114454) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3-methylphenoxy)-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 47114454 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-(3-methylphenoxy)-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | Cc1cccc(OCC(=O)NC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-12-4-3-5-14(10-12)19-11-15(18)16-13-6-8-17(2)9-7-13/h3-5,10,13H,6-9,11H2,1-2H3,(H,16,18) |
| InChIKey | NDRFHCKYIFXBQA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |