About N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide
N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 47115997) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| PubChem CID | 47115997 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCCCCCNC(=O)CSc1nncn1C |
| InChI | InChI=1S/C11H20N4OS/c1-3-4-5-6-7-12-10(16)8-17-11-14-13-9-15(11)2/h9H,3-8H2,1-2H3,(H,12,16) |
| InChIKey | OKMBXFKTNQCFIL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide?
The IUPAC name of N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (CID 47115997) is N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
What is the SMILES notation for N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide?
The canonical SMILES for N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide is CCCCCCNC(=O)CSc1nncn1C.
What is the InChIKey of N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide?
The InChIKey is OKMBXFKTNQCFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-3-4-5-6-7-12-10(16)8-17-11-14-13-9-15(11)2/h9H,3-8H2,1-2H3,(H,12,16).
What are the key properties of N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide?
N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide has a molecular weight of 256.37 g/mol, XLogP of 1.60, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetamide is sourced from PubChem (CID 47115997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).