C11H14N4O4 — CID 47117374
3-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 47117374) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 3-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | 3-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 47117374 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCN2C(=O)CN(C)C2=O)no1 |
| InChI | InChI=1S/C11H14N4O4/c1-7-5-8(13-19-7)12-9(16)3-4-15-10(17)6-14(2)11(15)18/h5H,3-4,6H2,1-2H3,(H,12,13,16) |
| InChIKey | KREQONMZDWUMCI-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|