C13H18N2O2 — CID 47117479
1-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-ethylurea (PubChem CID 47117479) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-ethylurea.
| Compound Name | 1-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-ethylurea |
|---|---|
| PubChem CID | 47117479 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-3-ylmethyl)-3-ethylurea |
| SMILES | CCNC(=O)NCC1COc2ccccc2C1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-14-13(16)15-8-10-7-11-5-3-4-6-12(11)17-9-10/h3-6,10H,2,7-9H2,1H3,(H2,14,15,16) |
| InChIKey | LCCFPVVROAZMTC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |