C12H21N5O2S — CID 47119014
N-ethyl-2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]propanamide (PubChem CID 47119014) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-ethyl-2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]propanamide.
| Compound Name | N-ethyl-2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 47119014 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-ethyl-2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]propanamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NC(C)C(=O)NCC |
| InChI | InChI=1S/C12H21N5O2S/c1-4-6-9-15-16-12(20)17(9)7-10(18)14-8(3)11(19)13-5-2/h8H,4-7H2,1-3H3,(H,13,19)(H,14,18)(H,16,20) |
| InChIKey | CXJFPBXNWVRMFE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|