About N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine
N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine (PubChem CID 4711971) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine |
| PubChem CID | 4711971 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine |
| SMILES | C=CCC(Nc1nccs1)C(C)C |
| InChI | InChI=1S/C10H16N2S/c1-4-5-9(8(2)3)12-10-11-6-7-13-10/h4,6-9H,1,5H2,2-3H3,(H,11,12) |
| InChIKey | QJROBOHUBCOYAR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine?
The IUPAC name of N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine (CID 4711971) is N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine?
The canonical SMILES for N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine is C=CCC(Nc1nccs1)C(C)C.
What is the InChIKey of N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine?
The InChIKey is QJROBOHUBCOYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-4-5-9(8(2)3)12-10-11-6-7-13-10/h4,6-9H,1,5H2,2-3H3,(H,11,12).
What are the key properties of N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine?
N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine has a molecular weight of 196.32 g/mol, XLogP of 3.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylhex-5-en-3-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 4711971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).