C18H38N4 — CID 4712087
N,N'-bis(1-methylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 4712087) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is N,N'-bis(1-methylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(1-methylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 4712087 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | N,N'-bis(1-methylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CN1CCC(NCCCCCCNC2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H38N4/c1-21-13-7-17(8-14-21)19-11-5-3-4-6-12-20-18-9-15-22(2)16-10-18/h17-20H,3-16H2,1-2H3 |
| InChIKey | RYNZOLKCLJHRCT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|