C11H13N3O4 — CID 47122051
1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-propan-2-ylimidazolidine-2,4,5-trione (PubChem CID 47122051) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-propan-2-ylimidazolidine-2,4,5-trione.
| Compound Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 47122051 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 1-[(3-methyl-1,2-oxazol-5-yl)methyl]-3-propan-2-ylimidazolidine-2,4,5-trione |
| SMILES | Cc1cc(CN2C(=O)C(=O)N(C(C)C)C2=O)on1 |
| InChI | InChI=1S/C11H13N3O4/c1-6(2)14-10(16)9(15)13(11(14)17)5-8-4-7(3)12-18-8/h4,6H,5H2,1-3H3 |
| InChIKey | TTYGAWAUQIXGBE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|