C11H8F2N2S — CID 47124414
2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidine (PubChem CID 47124414) has the molecular formula C11H8F2N2S and a molecular weight of 238.26 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidine.
| Compound Name | 2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 47124414 |
| Molecular Formula | C11H8F2N2S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methylsulfanyl]pyrimidine |
| SMILES | Fc1cccc(CSc2ncccn2)c1F |
| InChI | InChI=1S/C11H8F2N2S/c12-9-4-1-3-8(10(9)13)7-16-11-14-5-2-6-15-11/h1-6H,7H2 |
| InChIKey | YLRKMIMWCAHMIF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |