C13H14F3NO2 — CID 47126485
(E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 47126485) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 47126485 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (E)-3-[5-(2-methylcyclopropyl)furan-2-yl]-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CC1CC1c1ccc(/C=C/C(=O)NCC(F)(F)F)o1 |
| InChI | InChI=1S/C13H14F3NO2/c1-8-6-10(8)11-4-2-9(19-11)3-5-12(18)17-7-13(14,15)16/h2-5,8,10H,6-7H2,1H3,(H,17,18)/b5-3+ |
| InChIKey | OWVGMEGRGPTAFR-HWKANZROSA-N |
| XLogP | 3.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|