About 1-benzhydryl-1,3-dimethylurea
1-benzhydryl-1,3-dimethylurea (PubChem CID 47127259) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-benzhydryl-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-benzhydryl-1,3-dimethylurea |
| PubChem CID | 47127259 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-benzhydryl-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c1-17-16(19)18(2)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3,(H,17,19) |
| InChIKey | DNIHLEIUJDPCPE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzhydryl-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-1,3-dimethylurea?
The IUPAC name of 1-benzhydryl-1,3-dimethylurea (CID 47127259) is 1-benzhydryl-1,3-dimethylurea.
What is the SMILES notation for 1-benzhydryl-1,3-dimethylurea?
The canonical SMILES for 1-benzhydryl-1,3-dimethylurea is CNC(=O)N(C)C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-benzhydryl-1,3-dimethylurea?
The InChIKey is DNIHLEIUJDPCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c1-17-16(19)18(2)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15H,1-2H3,(H,17,19).
What are the key properties of 1-benzhydryl-1,3-dimethylurea?
1-benzhydryl-1,3-dimethylurea has a molecular weight of 254.33 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-1,3-dimethylurea is sourced from PubChem (CID 47127259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).