About 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide
3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 47129049) has the molecular formula C13H16ClNO3S
and a molecular weight of 301.79 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| PubChem CID | 47129049 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16ClNO3S/c14-11-3-1-2-10(8-11)4-5-13(16)15-12-6-7-19(17,18)9-12/h1-3,8,12H,4-7,9H2,(H,15,16) |
| InChIKey | JAYBUCIAAMYCME-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide?
The IUPAC name of 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide (CID 47129049) is 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide.
What is the SMILES notation for 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide?
The canonical SMILES for 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide is O=C(CCc1cccc(Cl)c1)NC1CCS(=O)(=O)C1.
What is the InChIKey of 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide?
The InChIKey is JAYBUCIAAMYCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO3S/c14-11-3-1-2-10(8-11)4-5-13(16)15-12-6-7-19(17,18)9-12/h1-3,8,12H,4-7,9H2,(H,15,16).
What are the key properties of 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide?
3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide has a molecular weight of 301.79 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)propanamide is sourced from PubChem (CID 47129049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).