C17H26N2O — CID 47132646
1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea (PubChem CID 47132646) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 47132646 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H26N2O/c1-12-10-13(2)16(14(3)11-12)19-17(20)18-15-8-6-4-5-7-9-15/h10-11,15H,4-9H2,1-3H3,(H2,18,19,20) |
| InChIKey | QQBKHRXLEIQCBK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |