C15H23BrN2O2 — CID 47133437
1-(2-bromo-4-methylphenyl)-3-[3-(2-methylpropoxy)propyl]urea (PubChem CID 47133437) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-[3-(2-methylpropoxy)propyl]urea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-[3-(2-methylpropoxy)propyl]urea |
|---|---|
| PubChem CID | 47133437 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-[3-(2-methylpropoxy)propyl]urea |
| SMILES | Cc1ccc(NC(=O)NCCCOCC(C)C)c(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-11(2)10-20-8-4-7-17-15(19)18-14-6-5-12(3)9-13(14)16/h5-6,9,11H,4,7-8,10H2,1-3H3,(H2,17,18,19) |
| InChIKey | FIXDLNFGFXDKDC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|