C9H14F3N3O2 — CID 47134202
1-N-(2,2,2-trifluoroethyl)piperidine-1,4-dicarboxamide (PubChem CID 47134202) has the molecular formula C9H14F3N3O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 1-N-(2,2,2-trifluoroethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(2,2,2-trifluoroethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 47134202 |
| Molecular Formula | C9H14F3N3O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-N-(2,2,2-trifluoroethyl)piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H14F3N3O2/c10-9(11,12)5-14-8(17)15-3-1-6(2-4-15)7(13)16/h6H,1-5H2,(H2,13,16)(H,14,17) |
| InChIKey | BGVYCYOHXIOGAE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |