C7H11F3N2O3S — CID 47134211
1-(1,1-dioxothiolan-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47134211) has the molecular formula C7H11F3N2O3S and a molecular weight of 260.24 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47134211 |
| Molecular Formula | C7H11F3N2O3S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCC(F)(F)F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H11F3N2O3S/c8-7(9,10)4-11-6(13)12-5-1-2-16(14,15)3-5/h5H,1-4H2,(H2,11,12,13) |
| InChIKey | NOYQHYWSOAZWJU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |