About 3-propan-2-yloxy-9H-pyrido[3,4-b]indole
3-propan-2-yloxy-9H-pyrido[3,4-b]indole (PubChem CID 4713435) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-propan-2-yloxy-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-propan-2-yloxy-9H-pyrido[3,4-b]indole |
| PubChem CID | 4713435 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-propan-2-yloxy-9H-pyrido[3,4-b]indole |
| SMILES | CC(C)Oc1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H14N2O/c1-9(2)17-14-7-11-10-5-3-4-6-12(10)16-13(11)8-15-14/h3-9,16H,1-2H3 |
| InChIKey | AKHQVIZELNFWSQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yloxy-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxy-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-propan-2-yloxy-9H-pyrido[3,4-b]indole (CID 4713435) is 3-propan-2-yloxy-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-propan-2-yloxy-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-propan-2-yloxy-9H-pyrido[3,4-b]indole is CC(C)Oc1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of 3-propan-2-yloxy-9H-pyrido[3,4-b]indole?
The InChIKey is AKHQVIZELNFWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-9(2)17-14-7-11-10-5-3-4-6-12(10)16-13(11)8-15-14/h3-9,16H,1-2H3.
What are the key properties of 3-propan-2-yloxy-9H-pyrido[3,4-b]indole?
3-propan-2-yloxy-9H-pyrido[3,4-b]indole has a molecular weight of 226.28 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxy-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 4713435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).