About 3-butoxy-9H-pyrido[3,4-b]indole
3-butoxy-9H-pyrido[3,4-b]indole (PubChem CID 4713436) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-butoxy-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-butoxy-9H-pyrido[3,4-b]indole |
| PubChem CID | 4713436 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-butoxy-9H-pyrido[3,4-b]indole |
| SMILES | CCCCOc1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C15H16N2O/c1-2-3-8-18-15-9-12-11-6-4-5-7-13(11)17-14(12)10-16-15/h4-7,9-10,17H,2-3,8H2,1H3 |
| InChIKey | UARMCWOWRLFTFP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-butoxy-9H-pyrido[3,4-b]indole (CID 4713436) is 3-butoxy-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-butoxy-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-butoxy-9H-pyrido[3,4-b]indole is CCCCOc1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of 3-butoxy-9H-pyrido[3,4-b]indole?
The InChIKey is UARMCWOWRLFTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c1-2-3-8-18-15-9-12-11-6-4-5-7-13(11)17-14(12)10-16-15/h4-7,9-10,17H,2-3,8H2,1H3.
What are the key properties of 3-butoxy-9H-pyrido[3,4-b]indole?
3-butoxy-9H-pyrido[3,4-b]indole has a molecular weight of 240.31 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 4713436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).