C18H13N3 — CID 4713441
17-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene (PubChem CID 4713441) has the molecular formula C18H13N3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 17-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene.
| Compound Name | 17-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 4713441 |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 17-methyl-9,12,20-triazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1(13),2(10),3,5,7,11,14,16,18-nonaene |
| SMILES | Cc1ccc2c(c1)[nH]c1c2ncc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C18H13N3/c1-10-6-7-12-14(8-10)21-18-16-11-4-2-3-5-13(11)20-15(16)9-19-17(12)18/h2-9,20-21H,1H3 |
| InChIKey | OXOPEGOTFPQEBO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |