About 3-nitro-9H-pyrido[3,4-b]indole
3-nitro-9H-pyrido[3,4-b]indole (PubChem CID 4713455) has the molecular formula C11H7N3O2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-nitro-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 3-nitro-9H-pyrido[3,4-b]indole |
| PubChem CID | 4713455 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 3-nitro-9H-pyrido[3,4-b]indole |
| SMILES | O=[N+]([O-])c1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C11H7N3O2/c15-14(16)11-5-8-7-3-1-2-4-9(7)13-10(8)6-12-11/h1-6,13H |
| InChIKey | XQNOYQREYCKAIN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-9H-pyrido[3,4-b]indole?
The IUPAC name of 3-nitro-9H-pyrido[3,4-b]indole (CID 4713455) is 3-nitro-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 3-nitro-9H-pyrido[3,4-b]indole?
The canonical SMILES for 3-nitro-9H-pyrido[3,4-b]indole is O=[N+]([O-])c1cc2c(cn1)[nH]c1ccccc12.
What is the InChIKey of 3-nitro-9H-pyrido[3,4-b]indole?
The InChIKey is XQNOYQREYCKAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2/c15-14(16)11-5-8-7-3-1-2-4-9(7)13-10(8)6-12-11/h1-6,13H.
What are the key properties of 3-nitro-9H-pyrido[3,4-b]indole?
3-nitro-9H-pyrido[3,4-b]indole has a molecular weight of 213.20 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 4713455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).