About ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate
ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate (PubChem CID 4713457) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate |
| PubChem CID | 4713457 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)[nH]c(=O)c1ccccc12 |
| InChI | InChI=1S/C15H12N2O3/c1-2-20-15(19)12-7-11-9-5-3-4-6-10(9)14(18)17-13(11)8-16-12/h3-8H,2H2,1H3,(H,17,18) |
| InChIKey | OUPZCGOUCCZYSN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate?
The IUPAC name of ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate (CID 4713457) is ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate?
The canonical SMILES for ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate is CCOC(=O)c1cc2c(cn1)[nH]c(=O)c1ccccc12.
What is the InChIKey of ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate?
The InChIKey is OUPZCGOUCCZYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c1-2-20-15(19)12-7-11-9-5-3-4-6-10(9)14(18)17-13(11)8-16-12/h3-8H,2H2,1H3,(H,17,18).
What are the key properties of ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate?
ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate has a molecular weight of 268.27 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-oxo-5H-benzo[c][1,7]naphthyridine-2-carboxylate is sourced from PubChem (CID 4713457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).