About ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate
ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate (PubChem CID 4713458) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 4713458 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cn1)sc1ccccc12 |
| InChI | InChI=1S/C14H11NO2S/c1-2-17-14(16)11-7-10-9-5-3-4-6-12(9)18-13(10)8-15-11/h3-8H,2H2,1H3 |
| InChIKey | DMLIEGFLXSROFK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate?
The IUPAC name of ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate (CID 4713458) is ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate is CCOC(=O)c1cc2c(cn1)sc1ccccc12.
What is the InChIKey of ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate?
The InChIKey is DMLIEGFLXSROFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c1-2-17-14(16)11-7-10-9-5-3-4-6-12(9)18-13(10)8-15-11/h3-8H,2H2,1H3.
What are the key properties of ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate?
ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate has a molecular weight of 257.31 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl [1]benzothiolo[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 4713458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).