C13H15N5OS — CID 47134888
N,N-bis(prop-2-enyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide (PubChem CID 47134888) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide.
| Compound Name | N,N-bis(prop-2-enyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47134888 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N,N-bis(prop-2-enyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CSc1nc2ncccn2n1 |
| InChI | InChI=1S/C13H15N5OS/c1-3-7-17(8-4-2)11(19)10-20-13-15-12-14-6-5-9-18(12)16-13/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | XYDOEWLQTJBUSB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|