About N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide
N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide (PubChem CID 47135643) has the molecular formula C6H8N4O2S2
and a molecular weight of 232.29 g/mol. Its IUPAC name is N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide.
Molecular Properties
| Compound Name | N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide |
| PubChem CID | 47135643 |
| Molecular Formula | C6H8N4O2S2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide |
| SMILES | NC(=O)NC(=O)CCSc1nncs1 |
| InChI | InChI=1S/C6H8N4O2S2/c7-5(12)9-4(11)1-2-13-6-10-8-3-14-6/h3H,1-2H2,(H3,7,9,11,12) |
| InChIKey | ZPCJRRDXJHXSLY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide?
The IUPAC name of N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide (CID 47135643) is N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide.
What is the SMILES notation for N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide?
The canonical SMILES for N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide is NC(=O)NC(=O)CCSc1nncs1.
What is the InChIKey of N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide?
The InChIKey is ZPCJRRDXJHXSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O2S2/c7-5(12)9-4(11)1-2-13-6-10-8-3-14-6/h3H,1-2H2,(H3,7,9,11,12).
What are the key properties of N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide?
N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide has a molecular weight of 232.29 g/mol, XLogP of 0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-3-(1,3,4-thiadiazol-2-ylsulfanyl)propanamide is sourced from PubChem (CID 47135643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).