C12H15N3O3S — CID 47135814
N-[1-oxo-1-(3-oxopiperazin-1-yl)propan-2-yl]thiophene-2-carboxamide (PubChem CID 47135814) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[1-oxo-1-(3-oxopiperazin-1-yl)propan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-oxo-1-(3-oxopiperazin-1-yl)propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47135814 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[1-oxo-1-(3-oxopiperazin-1-yl)propan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cccs1)C(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C12H15N3O3S/c1-8(14-11(17)9-3-2-6-19-9)12(18)15-5-4-13-10(16)7-15/h2-3,6,8H,4-5,7H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | PQTQZSCXBXURMN-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |