About 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol
4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol (PubChem CID 47135988) has the molecular formula C12H20ClN3O
and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol |
| PubChem CID | 47135988 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol |
| SMILES | Cc1nn(C)c(Cl)c1CNC1CCC(O)CC1 |
| InChI | InChI=1S/C12H20ClN3O/c1-8-11(12(13)16(2)15-8)7-14-9-3-5-10(17)6-4-9/h9-10,14,17H,3-7H2,1-2H3 |
| InChIKey | PRUBVRPQAISYLR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol?
The IUPAC name of 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol (CID 47135988) is 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol?
The canonical SMILES for 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol is Cc1nn(C)c(Cl)c1CNC1CCC(O)CC1.
What is the InChIKey of 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol?
The InChIKey is PRUBVRPQAISYLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN3O/c1-8-11(12(13)16(2)15-8)7-14-9-3-5-10(17)6-4-9/h9-10,14,17H,3-7H2,1-2H3.
What are the key properties of 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol?
4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol has a molecular weight of 257.76 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]cyclohexan-1-ol is sourced from PubChem (CID 47135988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).