About 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide
2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide (PubChem CID 4713777) has the molecular formula C22H16N2O3
and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide.
Molecular Properties
| Compound Name | 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide |
| PubChem CID | 4713777 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide |
| SMILES | O=C1C(=O)N(CC(=O)N(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H16N2O3/c25-20(15-23-19-14-8-7-13-18(19)21(26)22(23)27)24(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2 |
| InChIKey | YLTQKGBCYOKERC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide?
The IUPAC name of 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide (CID 4713777) is 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide.
What is the SMILES notation for 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide?
The canonical SMILES for 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide is O=C1C(=O)N(CC(=O)N(c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide?
The InChIKey is YLTQKGBCYOKERC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O3/c25-20(15-23-19-14-8-7-13-18(19)21(26)22(23)27)24(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2.
What are the key properties of 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide?
2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide has a molecular weight of 356.38 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dioxoindol-1-yl)-N,N-diphenylacetamide is sourced from PubChem (CID 4713777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).