C10H13N5O3 — CID 47138210
N-methoxy-N-methyl-2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetamide (PubChem CID 47138210) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is N-methoxy-N-methyl-2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetamide.
| Compound Name | N-methoxy-N-methyl-2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetamide |
|---|---|
| PubChem CID | 47138210 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | N-methoxy-N-methyl-2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetamide |
| SMILES | CON(C)C(=O)Cn1cnc2c(cnn2C)c1=O |
| InChI | InChI=1S/C10H13N5O3/c1-13-9-7(4-12-13)10(17)15(6-11-9)5-8(16)14(2)18-3/h4,6H,5H2,1-3H3 |
| InChIKey | SXGQFZFGXYGNPI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|