About 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one
2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one (PubChem CID 47138647) has the molecular formula C12H14N4OS
and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one |
| PubChem CID | 47138647 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one |
| SMILES | Cn1ncc2c(SC3CCCCC3=O)ncnc21 |
| InChI | InChI=1S/C12H14N4OS/c1-16-11-8(6-15-16)12(14-7-13-11)18-10-5-3-2-4-9(10)17/h6-7,10H,2-5H2,1H3 |
| InChIKey | GMUZYNFYSKQPOQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one?
The IUPAC name of 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one (CID 47138647) is 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one.
What is the SMILES notation for 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one?
The canonical SMILES for 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one is Cn1ncc2c(SC3CCCCC3=O)ncnc21.
What is the InChIKey of 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one?
The InChIKey is GMUZYNFYSKQPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS/c1-16-11-8(6-15-16)12(14-7-13-11)18-10-5-3-2-4-9(10)17/h6-7,10H,2-5H2,1H3.
What are the key properties of 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one?
2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one has a molecular weight of 262.34 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)sulfanylcyclohexan-1-one is sourced from PubChem (CID 47138647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).