C10H11ClF3N3O — CID 47139201
(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 47139201) has the molecular formula C10H11ClF3N3O and a molecular weight of 281.67 g/mol. Its IUPAC name is (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 47139201 |
| Molecular Formula | C10H11ClF3N3O |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H11ClF3N3O/c1-6-7(9(11)17(2)16-6)3-4-8(18)15-5-10(12,13)14/h3-4H,5H2,1-2H3,(H,15,18)/b4-3+ |
| InChIKey | DOGOLZQTZAMPLE-ONEGZZNKSA-N |
| XLogP | 2.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|