About [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate
[[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate (PubChem CID 4713969) has the molecular formula C17H19Br2NO2
and a molecular weight of 429.15 g/mol. Its IUPAC name is [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate.
Molecular Properties
| Compound Name | [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
| PubChem CID | 4713969 |
| Molecular Formula | C17H19Br2NO2 |
| Molecular Weight | 429.15 g/mol |
| Exact Mass | 426.98 |
| IUPAC Name | [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate |
| SMILES | CC12CCC(CC1=NOC(=O)c1ccc(Br)cc1)C2(C)CBr |
| InChI | InChI=1S/C17H19Br2NO2/c1-16-8-7-12(17(16,2)10-18)9-14(16)20-22-15(21)11-3-5-13(19)6-4-11/h3-6,12H,7-10H2,1-2H3 |
| InChIKey | BOGUYUCSHIUASW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.15 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate?
The IUPAC name of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate (CID 4713969) is [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate.
What is the SMILES notation for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate?
The canonical SMILES for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate is CC12CCC(CC1=NOC(=O)c1ccc(Br)cc1)C2(C)CBr.
What is the InChIKey of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate?
The InChIKey is BOGUYUCSHIUASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19Br2NO2/c1-16-8-7-12(17(16,2)10-18)9-14(16)20-22-15(21)11-3-5-13(19)6-4-11/h3-6,12H,7-10H2,1-2H3.
What are the key properties of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate?
[[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate has a molecular weight of 429.15 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-bromobenzoate is sourced from PubChem (CID 4713969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).