About 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide
2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide (PubChem CID 47141080) has the molecular formula C11H23N3O4S
and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide |
| PubChem CID | 47141080 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNS(=O)(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H23N3O4S/c1-4-5-12-11(15)6-13-19(16,17)14-7-9(2)18-10(3)8-14/h9-10,13H,4-8H2,1-3H3,(H,12,15) |
| InChIKey | CCNZQSSJAKYSAJ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide?
The IUPAC name of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide (CID 47141080) is 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide.
What is the SMILES notation for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide?
The canonical SMILES for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide is CCCNC(=O)CNS(=O)(=O)N1CC(C)OC(C)C1.
What is the InChIKey of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide?
The InChIKey is CCNZQSSJAKYSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O4S/c1-4-5-12-11(15)6-13-19(16,17)14-7-9(2)18-10(3)8-14/h9-10,13H,4-8H2,1-3H3,(H,12,15).
What are the key properties of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide?
2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide has a molecular weight of 293.39 g/mol, XLogP of -0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-N-propylacetamide is sourced from PubChem (CID 47141080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).