C16H15BrN2O3 — CID 4714172
phenyl N-[2-(4-bromoanilino)-2-oxoethyl]-N-methylcarbamate (PubChem CID 4714172) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is phenyl N-[2-(4-bromoanilino)-2-oxoethyl]-N-methylcarbamate.
| Compound Name | phenyl N-[2-(4-bromoanilino)-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 4714172 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | phenyl N-[2-(4-bromoanilino)-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)Nc1ccc(Br)cc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H15BrN2O3/c1-19(16(21)22-14-5-3-2-4-6-14)11-15(20)18-13-9-7-12(17)8-10-13/h2-10H,11H2,1H3,(H,18,20) |
| InChIKey | GQWWLPYOCQJCML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |