C13H15NO4S — CID 47145088
2-(4-methylsulfonylphenoxy)-N-prop-2-ynylpropanamide (PubChem CID 47145088) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenoxy)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(4-methylsulfonylphenoxy)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 47145088 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(4-methylsulfonylphenoxy)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Oc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H15NO4S/c1-4-9-14-13(15)10(2)18-11-5-7-12(8-6-11)19(3,16)17/h1,5-8,10H,9H2,2-3H3,(H,14,15) |
| InChIKey | GMKHPJJNXWSOHN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|