C14H17BrN2O — CID 47145310
2-[(4-bromophenyl)methyl-methylamino]-N-prop-2-ynylpropanamide (PubChem CID 47145310) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 47145310 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)N(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H17BrN2O/c1-4-9-16-14(18)11(2)17(3)10-12-5-7-13(15)8-6-12/h1,5-8,11H,9-10H2,2-3H3,(H,16,18) |
| InChIKey | JOQIVVALENLLHZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|