C12H17N3S4 — CID 47145472
2-butylsulfanyl-5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-1,3,4-thiadiazole (PubChem CID 47145472) has the molecular formula C12H17N3S4 and a molecular weight of 331.56 g/mol. Its IUPAC name is 2-butylsulfanyl-5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-butylsulfanyl-5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 47145472 |
| Molecular Formula | C12H17N3S4 |
| Molecular Weight | 331.56 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-butylsulfanyl-5-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]-1,3,4-thiadiazole |
| SMILES | CCCCSc1nnc(SCc2csc(CC)n2)s1 |
| InChI | InChI=1S/C12H17N3S4/c1-3-5-6-16-11-14-15-12(19-11)18-8-9-7-17-10(4-2)13-9/h7H,3-6,8H2,1-2H3 |
| InChIKey | FZXKCIFKNMZNSV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|