C9H13ClN4O — CID 47151307
1-(2-amino-6-chloropyrimidin-4-yl)piperidin-3-ol (PubChem CID 47151307) has the molecular formula C9H13ClN4O and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-(2-amino-6-chloropyrimidin-4-yl)piperidin-3-ol.
| Compound Name | 1-(2-amino-6-chloropyrimidin-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 47151307 |
| Molecular Formula | C9H13ClN4O |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1-(2-amino-6-chloropyrimidin-4-yl)piperidin-3-ol |
| SMILES | Nc1nc(Cl)cc(N2CCCC(O)C2)n1 |
| InChI | InChI=1S/C9H13ClN4O/c10-7-4-8(13-9(11)12-7)14-3-1-2-6(15)5-14/h4,6,15H,1-3,5H2,(H2,11,12,13) |
| InChIKey | ROCFIMCCBFEAAG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |