About 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide
2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide (PubChem CID 47151722) has the molecular formula C11H23N3O3S
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide |
| PubChem CID | 47151722 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H23N3O3S/c1-10(2)12-11(15)9-13-5-4-6-14(8-7-13)18(3,16)17/h10H,4-9H2,1-3H3,(H,12,15) |
| InChIKey | YKSMQYYQYRAHFX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide?
The IUPAC name of 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide (CID 47151722) is 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide?
The canonical SMILES for 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide is CC(C)NC(=O)CN1CCCN(S(C)(=O)=O)CC1.
What is the InChIKey of 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide?
The InChIKey is YKSMQYYQYRAHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O3S/c1-10(2)12-11(15)9-13-5-4-6-14(8-7-13)18(3,16)17/h10H,4-9H2,1-3H3,(H,12,15).
What are the key properties of 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide?
2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide has a molecular weight of 277.39 g/mol, XLogP of -0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylsulfonyl-1,4-diazepan-1-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 47151722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).