About 1-(4-butylphenyl)pyrrole
1-(4-butylphenyl)pyrrole (PubChem CID 4715223) has the molecular formula C14H17N
and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(4-butylphenyl)pyrrole.
Molecular Properties
| Compound Name | 1-(4-butylphenyl)pyrrole |
| PubChem CID | 4715223 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1-(4-butylphenyl)pyrrole |
| SMILES | CCCCc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C14H17N/c1-2-3-6-13-7-9-14(10-8-13)15-11-4-5-12-15/h4-5,7-12H,2-3,6H2,1H3 |
| InChIKey | VRCZCKZILHBDEY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-butylphenyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butylphenyl)pyrrole?
The IUPAC name of 1-(4-butylphenyl)pyrrole (CID 4715223) is 1-(4-butylphenyl)pyrrole.
What is the SMILES notation for 1-(4-butylphenyl)pyrrole?
The canonical SMILES for 1-(4-butylphenyl)pyrrole is CCCCc1ccc(-n2cccc2)cc1.
What is the InChIKey of 1-(4-butylphenyl)pyrrole?
The InChIKey is VRCZCKZILHBDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N/c1-2-3-6-13-7-9-14(10-8-13)15-11-4-5-12-15/h4-5,7-12H,2-3,6H2,1H3.
What are the key properties of 1-(4-butylphenyl)pyrrole?
1-(4-butylphenyl)pyrrole has a molecular weight of 199.30 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butylphenyl)pyrrole is sourced from PubChem (CID 4715223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).