About 2-(3,4-dimethylphenyl)pyrrolidine
2-(3,4-dimethylphenyl)pyrrolidine (PubChem CID 4715235) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)pyrrolidine.
Molecular Properties
| Compound Name | 2-(3,4-dimethylphenyl)pyrrolidine |
| PubChem CID | 4715235 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-(3,4-dimethylphenyl)pyrrolidine |
| SMILES | Cc1ccc(C2CCCN2)cc1C |
| InChI | InChI=1S/C12H17N/c1-9-5-6-11(8-10(9)2)12-4-3-7-13-12/h5-6,8,12-13H,3-4,7H2,1-2H3 |
| InChIKey | UWEGZHRBGMAQHN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,4-dimethylphenyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethylphenyl)pyrrolidine?
The IUPAC name of 2-(3,4-dimethylphenyl)pyrrolidine (CID 4715235) is 2-(3,4-dimethylphenyl)pyrrolidine.
What is the SMILES notation for 2-(3,4-dimethylphenyl)pyrrolidine?
The canonical SMILES for 2-(3,4-dimethylphenyl)pyrrolidine is Cc1ccc(C2CCCN2)cc1C.
What is the InChIKey of 2-(3,4-dimethylphenyl)pyrrolidine?
The InChIKey is UWEGZHRBGMAQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-9-5-6-11(8-10(9)2)12-4-3-7-13-12/h5-6,8,12-13H,3-4,7H2,1-2H3.
What are the key properties of 2-(3,4-dimethylphenyl)pyrrolidine?
2-(3,4-dimethylphenyl)pyrrolidine has a molecular weight of 175.27 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethylphenyl)pyrrolidine is sourced from PubChem (CID 4715235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).