C10H13N7S — CID 47153947
2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]-6-methylpyrimidin-4-amine (PubChem CID 47153947) has the molecular formula C10H13N7S and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]-6-methylpyrimidin-4-amine.
| Compound Name | 2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 47153947 |
| Molecular Formula | C10H13N7S |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SCc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C10H13N7S/c1-6-4-8(11)13-10(12-6)18-5-9-14-15-16-17(9)7-2-3-7/h4,7H,2-3,5H2,1H3,(H2,11,12,13) |
| InChIKey | DSVGOCVOPRXNRH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |