C12H13NO4S3 — CID 47154675
3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 47154675) has the molecular formula C12H13NO4S3 and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47154675 |
| Molecular Formula | C12H13NO4S3 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 3-methylsulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C12H13NO4S3/c1-19(14,15)11-5-2-6-12(8-11)20(16,17)13-9-10-4-3-7-18-10/h2-8,13H,9H2,1H3 |
| InChIKey | DEMWSTCSAXFNOL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |