C12H13FN4O — CID 47161044
N-[(3-fluorophenyl)methyl]-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 47161044) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 47161044 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | O=C(CCn1cncn1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C12H13FN4O/c13-11-3-1-2-10(6-11)7-15-12(18)4-5-17-9-14-8-16-17/h1-3,6,8-9H,4-5,7H2,(H,15,18) |
| InChIKey | AWAVLKYYGONKND-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |