C15H21FN2O2 — CID 47164310
1-[(4-fluorophenyl)methyl]-1-methyl-3-[1-(oxolan-2-yl)ethyl]urea (PubChem CID 47164310) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-methyl-3-[1-(oxolan-2-yl)ethyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-methyl-3-[1-(oxolan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 47164310 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-methyl-3-[1-(oxolan-2-yl)ethyl]urea |
| SMILES | CC(NC(=O)N(C)Cc1ccc(F)cc1)C1CCCO1 |
| InChI | InChI=1S/C15H21FN2O2/c1-11(14-4-3-9-20-14)17-15(19)18(2)10-12-5-7-13(16)8-6-12/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,17,19) |
| InChIKey | GDRUXEJVEBEXLZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |