About 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane
1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane (PubChem CID 47164701) has the molecular formula C12H23N3O2S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane |
| PubChem CID | 47164701 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane |
| SMILES | CC1CCCC(NS(=O)(=O)N(C)CCC#N)C1C |
| InChI | InChI=1S/C12H23N3O2S/c1-10-6-4-7-12(11(10)2)14-18(16,17)15(3)9-5-8-13/h10-12,14H,4-7,9H2,1-3H3 |
| InChIKey | ZQFDLHPCHYCKEC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane?
The IUPAC name of 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane (CID 47164701) is 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane.
What is the SMILES notation for 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane?
The canonical SMILES for 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane is CC1CCCC(NS(=O)(=O)N(C)CCC#N)C1C.
What is the InChIKey of 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane?
The InChIKey is ZQFDLHPCHYCKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2S/c1-10-6-4-7-12(11(10)2)14-18(16,17)15(3)9-5-8-13/h10-12,14H,4-7,9H2,1-3H3.
What are the key properties of 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane?
1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane has a molecular weight of 273.40 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-2,3-dimethylcyclohexane is sourced from PubChem (CID 47164701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).