C12H13BrClN3O2S — CID 47164706
N-[1-(4-bromophenyl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide (PubChem CID 47164706) has the molecular formula C12H13BrClN3O2S and a molecular weight of 378.68 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 47164706 |
| Molecular Formula | C12H13BrClN3O2S |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-5-chloro-1-methylimidazole-4-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1ncn(C)c1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrClN3O2S/c1-8(9-3-5-10(13)6-4-9)16-20(18,19)12-11(14)17(2)7-15-12/h3-8,16H,1-2H3 |
| InChIKey | VHCGYRWITAODHF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |