C13H17IN2O2 — CID 47165784
2-iodo-N-[3-oxo-3-(propan-2-ylamino)propyl]benzamide (PubChem CID 47165784) has the molecular formula C13H17IN2O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is 2-iodo-N-[3-oxo-3-(propan-2-ylamino)propyl]benzamide.
| Compound Name | 2-iodo-N-[3-oxo-3-(propan-2-ylamino)propyl]benzamide |
|---|---|
| PubChem CID | 47165784 |
| Molecular Formula | C13H17IN2O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-iodo-N-[3-oxo-3-(propan-2-ylamino)propyl]benzamide |
| SMILES | CC(C)NC(=O)CCNC(=O)c1ccccc1I |
| InChI | InChI=1S/C13H17IN2O2/c1-9(2)16-12(17)7-8-15-13(18)10-5-3-4-6-11(10)14/h3-6,9H,7-8H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | ZETYNBHZRRZBSE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|