C21H31NO — CID 4717237
N-[(3-ethoxyphenyl)methyl]-3,5-dimethyladamantan-1-amine (PubChem CID 4717237) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-3,5-dimethyladamantan-1-amine.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-3,5-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 4717237 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-3,5-dimethyladamantan-1-amine |
| SMILES | CCOc1cccc(CNC23CC4CC(C)(CC(C)(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H31NO/c1-4-23-18-7-5-6-16(8-18)12-22-21-11-17-9-19(2,14-21)13-20(3,10-17)15-21/h5-8,17,22H,4,9-15H2,1-3H3 |
| InChIKey | QGKXKCGTEYLTRR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |